C7H4F2INO — CID 121345074
2,3-difluoro-5-iodobenzamide (PubChem CID 121345074) has the molecular formula C7H4F2INO and a molecular weight of 283.01 g/mol. Its IUPAC name is 2,3-difluoro-5-iodobenzamide.
| Compound Name | 2,3-difluoro-5-iodobenzamide |
|---|---|
| PubChem CID | 121345074 |
| Molecular Formula | C7H4F2INO |
| Molecular Weight | 283.01 g/mol |
| Exact Mass | 282.93 |
| IUPAC Name | 2,3-difluoro-5-iodobenzamide |
| SMILES | NC(=O)c1cc(I)cc(F)c1F |
| InChI | InChI=1S/C7H4F2INO/c8-5-2-3(10)1-4(6(5)9)7(11)12/h1-2H,(H2,11,12) |
| InChIKey | GDGYBCWQIXFQGI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.01 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|