About (2,6-difluoro-4-iodophenyl) carbamate
(2,6-difluoro-4-iodophenyl) carbamate (PubChem CID 175005492) has the molecular formula C7H4F2INO2
and a molecular weight of 299.01 g/mol. Its IUPAC name is (2,6-difluoro-4-iodophenyl) carbamate.
Molecular Properties
| Compound Name | (2,6-difluoro-4-iodophenyl) carbamate |
| PubChem CID | 175005492 |
| Molecular Formula | C7H4F2INO2 |
| Molecular Weight | 299.01 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | (2,6-difluoro-4-iodophenyl) carbamate |
| SMILES | NC(=O)Oc1c(F)cc(I)cc1F |
| InChI | InChI=1S/C7H4F2INO2/c8-4-1-3(10)2-5(9)6(4)13-7(11)12/h1-2H,(H2,11,12) |
| InChIKey | MWOROHCLRXMEGB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.01 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2,6-difluoro-4-iodophenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluoro-4-iodophenyl) carbamate?
The IUPAC name of (2,6-difluoro-4-iodophenyl) carbamate (CID 175005492) is (2,6-difluoro-4-iodophenyl) carbamate.
What is the SMILES notation for (2,6-difluoro-4-iodophenyl) carbamate?
The canonical SMILES for (2,6-difluoro-4-iodophenyl) carbamate is NC(=O)Oc1c(F)cc(I)cc1F.
What is the InChIKey of (2,6-difluoro-4-iodophenyl) carbamate?
The InChIKey is MWOROHCLRXMEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2INO2/c8-4-1-3(10)2-5(9)6(4)13-7(11)12/h1-2H,(H2,11,12).
What are the key properties of (2,6-difluoro-4-iodophenyl) carbamate?
(2,6-difluoro-4-iodophenyl) carbamate has a molecular weight of 299.01 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluoro-4-iodophenyl) carbamate is sourced from PubChem (CID 175005492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).