potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate

C9H6F2KNO4 — CID 167519028

IUPACpotassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate
SMILESNC(=O)Oc1c(F)cc(CO[C-]=O)cc1F.[K+]
InChIInChI=1S/C9H6F2NO4.K/c10-6-1-5(3-15-4-13)2-7(11)8(6)16-9(12)14;/h1-2H,3H2,(H2,12,14);/q-1;+1
InChIKeyPQVQBXULUQKSSJ-UHFFFAOYSA-N
MW269.24 g/mol
LogP-1.99
Rot. Bonds4

About potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate

potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate (PubChem CID 167519028) has the molecular formula C9H6F2KNO4 and a molecular weight of 269.24 g/mol. Its IUPAC name is potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate.

Molecular Properties

Compound Namepotassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate
PubChem CID167519028
Molecular FormulaC9H6F2KNO4
Molecular Weight269.24 g/mol
Exact Mass268.99
IUPAC Namepotassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate
SMILESNC(=O)Oc1c(F)cc(CO[C-]=O)cc1F.[K+]
InChIInChI=1S/C9H6F2NO4.K/c10-6-1-5(3-15-4-13)2-7(11)8(6)16-9(12)14;/h1-2H,3H2,(H2,12,14);/q-1;+1
InChIKeyPQVQBXULUQKSSJ-UHFFFAOYSA-N
XLogP-1.99
TPSA78.62 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.24
LogP ≤ 5-1.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate?
The IUPAC name of potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate (CID 167519028) is potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate.
What is the SMILES notation for potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate?
The canonical SMILES for potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate is NC(=O)Oc1c(F)cc(CO[C-]=O)cc1F.[K+].
What is the InChIKey of potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate?
The InChIKey is PQVQBXULUQKSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2NO4.K/c10-6-1-5(3-15-4-13)2-7(11)8(6)16-9(12)14;/h1-2H,3H2,(H2,12,14);/q-1;+1.
What are the key properties of potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate?
potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate has a molecular weight of 269.24 g/mol, XLogP of -1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate is sourced from PubChem (CID 167519028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).