C9H6F2KNO4 — CID 167519028
potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate (PubChem CID 167519028) has the molecular formula C9H6F2KNO4 and a molecular weight of 269.24 g/mol. Its IUPAC name is potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate.
| Compound Name | potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate |
|---|---|
| PubChem CID | 167519028 |
| Molecular Formula | C9H6F2KNO4 |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | potassium [2,6-difluoro-4-(oxomethoxymethyl)phenyl] carbamate |
| SMILES | NC(=O)Oc1c(F)cc(CO[C-]=O)cc1F.[K+] |
| InChI | InChI=1S/C9H6F2NO4.K/c10-6-1-5(3-15-4-13)2-7(11)8(6)16-9(12)14;/h1-2H,3H2,(H2,12,14);/q-1;+1 |
| InChIKey | PQVQBXULUQKSSJ-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|