C15H19F2NO4 — CID 170256035
[2,6-difluoro-4-(propan-2-ylcarbamoyloxymethyl)phenyl] 2-methylpropanoate (PubChem CID 170256035) has the molecular formula C15H19F2NO4 and a molecular weight of 315.32 g/mol. Its IUPAC name is [2,6-difluoro-4-(propan-2-ylcarbamoyloxymethyl)phenyl] 2-methylpropanoate.
| Compound Name | [2,6-difluoro-4-(propan-2-ylcarbamoyloxymethyl)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 170256035 |
| Molecular Formula | C15H19F2NO4 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [2,6-difluoro-4-(propan-2-ylcarbamoyloxymethyl)phenyl] 2-methylpropanoate |
| SMILES | CC(C)NC(=O)OCc1cc(F)c(OC(=O)C(C)C)c(F)c1 |
| InChI | InChI=1S/C15H19F2NO4/c1-8(2)14(19)22-13-11(16)5-10(6-12(13)17)7-21-15(20)18-9(3)4/h5-6,8-9H,7H2,1-4H3,(H,18,20) |
| InChIKey | IOJNOIOJIZYTAE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|