C12H10F2O2 — CID 65428233
1-(4,6-difluoro-1-benzofuran-2-yl)-2-methylpropan-1-one (PubChem CID 65428233) has the molecular formula C12H10F2O2 and a molecular weight of 224.21 g/mol. Its IUPAC name is 1-(4,6-difluoro-1-benzofuran-2-yl)-2-methylpropan-1-one.
| Compound Name | 1-(4,6-difluoro-1-benzofuran-2-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 65428233 |
| Molecular Formula | C12H10F2O2 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-(4,6-difluoro-1-benzofuran-2-yl)-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)c1cc2c(F)cc(F)cc2o1 |
| InChI | InChI=1S/C12H10F2O2/c1-6(2)12(15)11-5-8-9(14)3-7(13)4-10(8)16-11/h3-6H,1-2H3 |
| InChIKey | AXCHULXQVZGWNF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |