C10H5F3O2 — CID 114726024
2,2-difluoro-1-(5-fluoro-1-benzofuran-2-yl)ethanone (PubChem CID 114726024) has the molecular formula C10H5F3O2 and a molecular weight of 214.14 g/mol. Its IUPAC name is 2,2-difluoro-1-(5-fluoro-1-benzofuran-2-yl)ethanone.
| Compound Name | 2,2-difluoro-1-(5-fluoro-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 114726024 |
| Molecular Formula | C10H5F3O2 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 2,2-difluoro-1-(5-fluoro-1-benzofuran-2-yl)ethanone |
| SMILES | O=C(c1cc2cc(F)ccc2o1)C(F)F |
| InChI | InChI=1S/C10H5F3O2/c11-6-1-2-7-5(3-6)4-8(15-7)9(14)10(12)13/h1-4,10H |
| InChIKey | MEFMFTIATRKLJR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |