C14H15FO4 — CID 114725706
2,2-diethoxy-1-(5-fluoro-1-benzofuran-2-yl)ethanone (PubChem CID 114725706) has the molecular formula C14H15FO4 and a molecular weight of 266.27 g/mol. Its IUPAC name is 2,2-diethoxy-1-(5-fluoro-1-benzofuran-2-yl)ethanone.
| Compound Name | 2,2-diethoxy-1-(5-fluoro-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 114725706 |
| Molecular Formula | C14H15FO4 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2,2-diethoxy-1-(5-fluoro-1-benzofuran-2-yl)ethanone |
| SMILES | CCOC(OCC)C(=O)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C14H15FO4/c1-3-17-14(18-4-2)13(16)12-8-9-7-10(15)5-6-11(9)19-12/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | CEEMSGATJPEINM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|