C11H4F6O2 — CID 114038355
2,2,3,3,3-pentafluoro-1-(5-fluoro-1-benzofuran-2-yl)propan-1-one (PubChem CID 114038355) has the molecular formula C11H4F6O2 and a molecular weight of 282.14 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(5-fluoro-1-benzofuran-2-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(5-fluoro-1-benzofuran-2-yl)propan-1-one |
|---|---|
| PubChem CID | 114038355 |
| Molecular Formula | C11H4F6O2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(5-fluoro-1-benzofuran-2-yl)propan-1-one |
| SMILES | O=C(c1cc2cc(F)ccc2o1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H4F6O2/c12-6-1-2-7-5(3-6)4-8(19-7)9(18)10(13,14)11(15,16)17/h1-4H |
| InChIKey | FBCXDSBVGCBVBG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|