C10H4BrF3O2 — CID 71301977
1-(5-bromo-1-benzofuran-2-yl)-2,2,2-trifluoroethanone (PubChem CID 71301977) has the molecular formula C10H4BrF3O2 and a molecular weight of 293.04 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 71301977 |
| Molecular Formula | C10H4BrF3O2 |
| Molecular Weight | 293.04 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cc2cc(Br)ccc2o1)C(F)(F)F |
| InChI | InChI=1S/C10H4BrF3O2/c11-6-1-2-7-5(3-6)4-8(16-7)9(15)10(12,13)14/h1-4H |
| InChIKey | PIDJQWJKUUOPBA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |