C17H13F2NO2 — CID 8782108
N-[(1S)-1-(2,4-difluorophenyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 8782108) has the molecular formula C17H13F2NO2 and a molecular weight of 301.29 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-difluorophenyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8782108 |
| Molecular Formula | C17H13F2NO2 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc2ccccc2o1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H13F2NO2/c1-10(13-7-6-12(18)9-14(13)19)20-17(21)16-8-11-4-2-3-5-15(11)22-16/h2-10H,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | KLGIDXITCHEVTC-JTQLQIEISA-N |
| XLogP | 4.20 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |