C15H15F2NO2 — CID 86930731
N-[1-(2,4-difluorophenyl)ethyl]-5-ethylfuran-2-carboxamide (PubChem CID 86930731) has the molecular formula C15H15F2NO2 and a molecular weight of 279.29 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-5-ethylfuran-2-carboxamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-5-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 86930731 |
| Molecular Formula | C15H15F2NO2 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-5-ethylfuran-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC(C)c2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C15H15F2NO2/c1-3-11-5-7-14(20-11)15(19)18-9(2)12-6-4-10(16)8-13(12)17/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | YTQKGQXNTLRARD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |