C17H18F2N2S — CID 8655777
1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(4-ethylphenyl)thiourea (PubChem CID 8655777) has the molecular formula C17H18F2N2S and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 8655777 |
| Molecular Formula | C17H18F2N2S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)N[C@@H](C)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H18F2N2S/c1-3-12-4-7-14(8-5-12)21-17(22)20-11(2)15-9-6-13(18)10-16(15)19/h4-11H,3H2,1-2H3,(H2,20,21,22)/t11-/m0/s1 |
| InChIKey | XFFGOXLVTAGDCG-NSHDSACASA-N |
| XLogP | 4.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|