C12H14F2N2S — CID 8678369
1-cyclopropyl-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea (PubChem CID 8678369) has the molecular formula C12H14F2N2S and a molecular weight of 256.32 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8678369 |
| Molecular Formula | C12H14F2N2S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-cyclopropyl-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea |
| SMILES | C[C@@H](NC(=S)NC1CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2S/c1-7(15-12(17)16-9-3-4-9)10-5-2-8(13)6-11(10)14/h2,5-7,9H,3-4H2,1H3,(H2,15,16,17)/t7-/m1/s1 |
| InChIKey | COZHBJCTVRMPHP-SSDOTTSWSA-N |
| XLogP | 2.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|