C15H19F2N — CID 43204151
N-(dicyclopropylmethyl)-1-(2,4-difluorophenyl)ethanamine (PubChem CID 43204151) has the molecular formula C15H19F2N and a molecular weight of 251.32 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-1-(2,4-difluorophenyl)ethanamine.
| Compound Name | N-(dicyclopropylmethyl)-1-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 43204151 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(dicyclopropylmethyl)-1-(2,4-difluorophenyl)ethanamine |
| SMILES | CC(NC(C1CC1)C1CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H19F2N/c1-9(13-7-6-12(16)8-14(13)17)18-15(10-2-3-10)11-4-5-11/h6-11,15,18H,2-5H2,1H3 |
| InChIKey | QYBRYWYTGHYUCS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |