C15H21NO2 — CID 43204126
4-[1-(dicyclopropylmethylamino)ethyl]benzene-1,3-diol (PubChem CID 43204126) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-[1-(dicyclopropylmethylamino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(dicyclopropylmethylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43204126 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-[1-(dicyclopropylmethylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NC(C1CC1)C1CC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H21NO2/c1-9(13-7-6-12(17)8-14(13)18)16-15(10-2-3-10)11-4-5-11/h6-11,15-18H,2-5H2,1H3 |
| InChIKey | OACBKPVZDNMBAH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|