C11H16N2O3 — CID 43545402
2-[1-(2,4-dihydroxyphenyl)ethylamino]propanamide (PubChem CID 43545402) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[1-(2,4-dihydroxyphenyl)ethylamino]propanamide.
| Compound Name | 2-[1-(2,4-dihydroxyphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 43545402 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-[1-(2,4-dihydroxyphenyl)ethylamino]propanamide |
| SMILES | CC(NC(C)c1ccc(O)cc1O)C(N)=O |
| InChI | InChI=1S/C11H16N2O3/c1-6(13-7(2)11(12)16)9-4-3-8(14)5-10(9)15/h3-7,13-15H,1-2H3,(H2,12,16) |
| InChIKey | WMHPUUTYGHQEJD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|