C16H15ClF2N2S — CID 8678334
1-(3-chloro-4-methylphenyl)-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea (PubChem CID 8678334) has the molecular formula C16H15ClF2N2S and a molecular weight of 340.83 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8678334 |
| Molecular Formula | C16H15ClF2N2S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[(1R)-1-(2,4-difluorophenyl)ethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H](C)c2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C16H15ClF2N2S/c1-9-3-5-12(8-14(9)17)21-16(22)20-10(2)13-6-4-11(18)7-15(13)19/h3-8,10H,1-2H3,(H2,20,21,22)/t10-/m1/s1 |
| InChIKey | DXZRZNLJBFVGLX-SNVBAGLBSA-N |
| XLogP | 4.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|