C11H8FNO3 — CID 139338161
6-fluoro-N-methyl-4-oxochromene-2-carboxamide (PubChem CID 139338161) has the molecular formula C11H8FNO3 and a molecular weight of 221.19 g/mol. Its IUPAC name is 6-fluoro-N-methyl-4-oxochromene-2-carboxamide.
| Compound Name | 6-fluoro-N-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 139338161 |
| Molecular Formula | C11H8FNO3 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 6-fluoro-N-methyl-4-oxochromene-2-carboxamide |
| SMILES | CNC(=O)c1cc(=O)c2cc(F)ccc2o1 |
| InChI | InChI=1S/C11H8FNO3/c1-13-11(15)10-5-8(14)7-4-6(12)2-3-9(7)16-10/h2-5H,1H3,(H,13,15) |
| InChIKey | SFVJBKLIRVQQHB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |