C20H23FN2O5 — CID 11974459
tert-butyl 4-[(6-fluoro-4-oxochromene-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 11974459) has the molecular formula C20H23FN2O5 and a molecular weight of 390.41 g/mol. Its IUPAC name is tert-butyl 4-[(6-fluoro-4-oxochromene-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-fluoro-4-oxochromene-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11974459 |
| Molecular Formula | C20H23FN2O5 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | tert-butyl 4-[(6-fluoro-4-oxochromene-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc(=O)c3cc(F)ccc3o2)CC1 |
| InChI | InChI=1S/C20H23FN2O5/c1-20(2,3)28-19(26)23-8-6-13(7-9-23)22-18(25)17-11-15(24)14-10-12(21)4-5-16(14)27-17/h4-5,10-11,13H,6-9H2,1-3H3,(H,22,25) |
| InChIKey | CIPDOAAFFBDENV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |