About furan-3-ylmethyl N-propan-2-ylcarbamate
furan-3-ylmethyl N-propan-2-ylcarbamate (PubChem CID 58805073) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is furan-3-ylmethyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | furan-3-ylmethyl N-propan-2-ylcarbamate |
| PubChem CID | 58805073 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | furan-3-ylmethyl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OCc1ccoc1 |
| InChI | InChI=1S/C9H13NO3/c1-7(2)10-9(11)13-6-8-3-4-12-5-8/h3-5,7H,6H2,1-2H3,(H,10,11) |
| InChIKey | HWINMYVQULTXQP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-3-ylmethyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-ylmethyl N-propan-2-ylcarbamate?
The IUPAC name of furan-3-ylmethyl N-propan-2-ylcarbamate (CID 58805073) is furan-3-ylmethyl N-propan-2-ylcarbamate.
What is the SMILES notation for furan-3-ylmethyl N-propan-2-ylcarbamate?
The canonical SMILES for furan-3-ylmethyl N-propan-2-ylcarbamate is CC(C)NC(=O)OCc1ccoc1.
What is the InChIKey of furan-3-ylmethyl N-propan-2-ylcarbamate?
The InChIKey is HWINMYVQULTXQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-7(2)10-9(11)13-6-8-3-4-12-5-8/h3-5,7H,6H2,1-2H3,(H,10,11).
What are the key properties of furan-3-ylmethyl N-propan-2-ylcarbamate?
furan-3-ylmethyl N-propan-2-ylcarbamate has a molecular weight of 183.21 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-ylmethyl N-propan-2-ylcarbamate is sourced from PubChem (CID 58805073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).