About furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate
furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate (PubChem CID 97262289) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate.
Molecular Properties
| Compound Name | furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate |
| PubChem CID | 97262289 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate |
| SMILES | CCN(CC)[C@H](C(=O)OCc1ccoc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-3-18(4-2)16(15-8-6-5-7-9-15)17(19)21-13-14-10-11-20-12-14/h5-12,16H,3-4,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | ZCLOJQCWRXPEMV-INIZCTEOSA-N |
| XLogP | 3.41 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate?
The IUPAC name of furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate (CID 97262289) is furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate.
What is the SMILES notation for furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate?
The canonical SMILES for furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate is CCN(CC)[C@H](C(=O)OCc1ccoc1)c1ccccc1.
What is the InChIKey of furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate?
The InChIKey is ZCLOJQCWRXPEMV-INIZCTEOSA-N. The full InChI is InChI=1S/C17H21NO3/c1-3-18(4-2)16(15-8-6-5-7-9-15)17(19)21-13-14-10-11-20-12-14/h5-12,16H,3-4,13H2,1-2H3/t16-/m0/s1.
What are the key properties of furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate?
furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate has a molecular weight of 287.36 g/mol, XLogP of 3.41, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-ylmethyl (2S)-2-(diethylamino)-2-phenylacetate is sourced from PubChem (CID 97262289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).