About furan-3-ylmethyl N-methylcarbamate
furan-3-ylmethyl N-methylcarbamate (PubChem CID 57025329) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is furan-3-ylmethyl N-methylcarbamate.
Molecular Properties
| Compound Name | furan-3-ylmethyl N-methylcarbamate |
| PubChem CID | 57025329 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | furan-3-ylmethyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccoc1 |
| InChI | InChI=1S/C7H9NO3/c1-8-7(9)11-5-6-2-3-10-4-6/h2-4H,5H2,1H3,(H,8,9) |
| InChIKey | UVZWDDYFNHEEHW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-3-ylmethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-ylmethyl N-methylcarbamate?
The IUPAC name of furan-3-ylmethyl N-methylcarbamate (CID 57025329) is furan-3-ylmethyl N-methylcarbamate.
What is the SMILES notation for furan-3-ylmethyl N-methylcarbamate?
The canonical SMILES for furan-3-ylmethyl N-methylcarbamate is CNC(=O)OCc1ccoc1.
What is the InChIKey of furan-3-ylmethyl N-methylcarbamate?
The InChIKey is UVZWDDYFNHEEHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-8-7(9)11-5-6-2-3-10-4-6/h2-4H,5H2,1H3,(H,8,9).
What are the key properties of furan-3-ylmethyl N-methylcarbamate?
furan-3-ylmethyl N-methylcarbamate has a molecular weight of 155.15 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-ylmethyl N-methylcarbamate is sourced from PubChem (CID 57025329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).