C8H11NO5 — CID 173422015
[2-(dihydroxymethyl)furan-3-yl]methyl N-methylcarbamate (PubChem CID 173422015) has the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. Its IUPAC name is [2-(dihydroxymethyl)furan-3-yl]methyl N-methylcarbamate.
| Compound Name | [2-(dihydroxymethyl)furan-3-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 173422015 |
| Molecular Formula | C8H11NO5 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | [2-(dihydroxymethyl)furan-3-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccoc1C(O)O |
| InChI | InChI=1S/C8H11NO5/c1-9-8(12)14-4-5-2-3-13-6(5)7(10)11/h2-3,7,10-11H,4H2,1H3,(H,9,12) |
| InChIKey | ASQODPVTZPDNIG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|