C11H16ClN3O4 — CID 664418
hydron;[6-(methylcarbamoyloxymethyl)-2-pyridinyl]methyl N-methylcarbamate;chloride (PubChem CID 664418) has the molecular formula C11H16ClN3O4 and a molecular weight of 289.72 g/mol. Its IUPAC name is hydron;[6-(methylcarbamoyloxymethyl)-2-pyridinyl]methyl N-methylcarbamate;chloride.
| Compound Name | hydron;[6-(methylcarbamoyloxymethyl)-2-pyridinyl]methyl N-methylcarbamate;chloride |
|---|---|
| PubChem CID | 664418 |
| Molecular Formula | C11H16ClN3O4 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | hydron;[6-(methylcarbamoyloxymethyl)-2-pyridinyl]methyl N-methylcarbamate;chloride |
| SMILES | CNC(=O)OCc1cccc(COC(=O)NC)n1.[Cl-].[H+] |
| InChI | InChI=1S/C11H15N3O4.ClH/c1-12-10(15)17-6-8-4-3-5-9(14-8)7-18-11(16)13-2;/h3-5H,6-7H2,1-2H3,(H,12,15)(H,13,16);1H |
| InChIKey | HRFLYRXEGCPAII-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |