About anthracen-9-ylmethyl N-methylcarbamate
anthracen-9-ylmethyl N-methylcarbamate (PubChem CID 90378707) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is anthracen-9-ylmethyl N-methylcarbamate.
Molecular Properties
| Compound Name | anthracen-9-ylmethyl N-methylcarbamate |
| PubChem CID | 90378707 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | anthracen-9-ylmethyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C17H15NO2/c1-18-17(19)20-11-16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-10H,11H2,1H3,(H,18,19) |
| InChIKey | AAYWAEYRQCMRBU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-ylmethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-ylmethyl N-methylcarbamate?
The IUPAC name of anthracen-9-ylmethyl N-methylcarbamate (CID 90378707) is anthracen-9-ylmethyl N-methylcarbamate.
What is the SMILES notation for anthracen-9-ylmethyl N-methylcarbamate?
The canonical SMILES for anthracen-9-ylmethyl N-methylcarbamate is CNC(=O)OCc1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracen-9-ylmethyl N-methylcarbamate?
The InChIKey is AAYWAEYRQCMRBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c1-18-17(19)20-11-16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-10H,11H2,1H3,(H,18,19).
What are the key properties of anthracen-9-ylmethyl N-methylcarbamate?
anthracen-9-ylmethyl N-methylcarbamate has a molecular weight of 265.31 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-ylmethyl N-methylcarbamate is sourced from PubChem (CID 90378707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).