About 1-naphthalen-1-ylethyl carbamate
1-naphthalen-1-ylethyl carbamate (PubChem CID 14959373) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-naphthalen-1-ylethyl carbamate.
Molecular Properties
| Compound Name | 1-naphthalen-1-ylethyl carbamate |
| PubChem CID | 14959373 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-naphthalen-1-ylethyl carbamate |
| SMILES | CC(OC(N)=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H13NO2/c1-9(16-13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h2-9H,1H3,(H2,14,15) |
| InChIKey | GKGCPJFQPWIDRK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-naphthalen-1-ylethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-naphthalen-1-ylethyl carbamate?
The IUPAC name of 1-naphthalen-1-ylethyl carbamate (CID 14959373) is 1-naphthalen-1-ylethyl carbamate.
What is the SMILES notation for 1-naphthalen-1-ylethyl carbamate?
The canonical SMILES for 1-naphthalen-1-ylethyl carbamate is CC(OC(N)=O)c1cccc2ccccc12.
What is the InChIKey of 1-naphthalen-1-ylethyl carbamate?
The InChIKey is GKGCPJFQPWIDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c1-9(16-13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h2-9H,1H3,(H2,14,15).
What are the key properties of 1-naphthalen-1-ylethyl carbamate?
1-naphthalen-1-ylethyl carbamate has a molecular weight of 215.25 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-naphthalen-1-ylethyl carbamate is sourced from PubChem (CID 14959373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).