About dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate
dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate (PubChem CID 102414342) has the molecular formula C26H22O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate.
Molecular Properties
| Compound Name | dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate |
| PubChem CID | 102414342 |
| Molecular Formula | C26H22O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H22O3/c1-17(18(2)27)26(28)29-25(23-15-7-11-19-9-3-5-13-21(19)23)24-16-8-12-20-10-4-6-14-22(20)24/h3-17,25H,1-2H3 |
| InChIKey | QLLKANHIVDACMT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate?
The IUPAC name of dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate (CID 102414342) is dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate.
What is the SMILES notation for dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate?
The canonical SMILES for dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate is CC(=O)C(C)C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12.
What is the InChIKey of dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate?
The InChIKey is QLLKANHIVDACMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O3/c1-17(18(2)27)26(28)29-25(23-15-7-11-19-9-3-5-13-21(19)23)24-16-8-12-20-10-4-6-14-22(20)24/h3-17,25H,1-2H3.
What are the key properties of dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate?
dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate has a molecular weight of 382.46 g/mol, XLogP of 5.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dinaphthalen-1-ylmethyl 2-methyl-3-oxobutanoate is sourced from PubChem (CID 102414342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).