About dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate
dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate (PubChem CID 121278698) has the molecular formula C30H23ClO2
and a molecular weight of 450.97 g/mol. Its IUPAC name is dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate.
Molecular Properties
| Compound Name | dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate |
| PubChem CID | 121278698 |
| Molecular Formula | C30H23ClO2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate |
| SMILES | C[C@@H](C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C30H23ClO2/c1-20(23-14-6-7-19-28(23)31)30(32)33-29(26-17-8-12-21-10-2-4-15-24(21)26)27-18-9-13-22-11-3-5-16-25(22)27/h2-20,29H,1H3/t20-/m1/s1 |
| InChIKey | IVGNTTOFOUPKPV-HXUWFJFHSA-N |
| XLogP | 8.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate?
The IUPAC name of dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate (CID 121278698) is dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate.
What is the SMILES notation for dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate?
The canonical SMILES for dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate is C[C@@H](C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12)c1ccccc1Cl.
What is the InChIKey of dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate?
The InChIKey is IVGNTTOFOUPKPV-HXUWFJFHSA-N. The full InChI is InChI=1S/C30H23ClO2/c1-20(23-14-6-7-19-28(23)31)30(32)33-29(26-17-8-12-21-10-2-4-15-24(21)26)27-18-9-13-22-11-3-5-16-25(22)27/h2-20,29H,1H3/t20-/m1/s1.
What are the key properties of dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate?
dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate has a molecular weight of 450.97 g/mol, XLogP of 8.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dinaphthalen-1-ylmethyl (2R)-2-(2-chlorophenyl)propanoate is sourced from PubChem (CID 121278698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).