About dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate
dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate (PubChem CID 166440080) has the molecular formula C30H24O3
and a molecular weight of 432.52 g/mol. Its IUPAC name is dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate.
Molecular Properties
| Compound Name | dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate |
| PubChem CID | 166440080 |
| Molecular Formula | C30H24O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H24O3/c1-21(32-24-15-3-2-4-16-24)30(31)33-29(27-19-9-13-22-11-5-7-17-25(22)27)28-20-10-14-23-12-6-8-18-26(23)28/h2-21,29H,1H3/t21-/m1/s1 |
| InChIKey | LHTHHWNLVDKCOZ-OAQYLSRUSA-N |
| XLogP | 7.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate?
The IUPAC name of dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate (CID 166440080) is dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate.
What is the SMILES notation for dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate?
The canonical SMILES for dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate is C[C@@H](Oc1ccccc1)C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12.
What is the InChIKey of dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate?
The InChIKey is LHTHHWNLVDKCOZ-OAQYLSRUSA-N. The full InChI is InChI=1S/C30H24O3/c1-21(32-24-15-3-2-4-16-24)30(31)33-29(27-19-9-13-22-11-5-7-17-25(22)27)28-20-10-14-23-12-6-8-18-26(23)28/h2-21,29H,1H3/t21-/m1/s1.
What are the key properties of dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate?
dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate has a molecular weight of 432.52 g/mol, XLogP of 7.09, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dinaphthalen-1-ylmethyl (2R)-2-phenoxypropanoate is sourced from PubChem (CID 166440080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).