About dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate
dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate (PubChem CID 166440086) has the molecular formula C32H28O3
and a molecular weight of 460.57 g/mol. Its IUPAC name is dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate.
Molecular Properties
| Compound Name | dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate |
| PubChem CID | 166440086 |
| Molecular Formula | C32H28O3 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate |
| SMILES | CCC[C@@H](Oc1ccccc1)C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H28O3/c1-2-12-30(34-25-17-4-3-5-18-25)32(33)35-31(28-21-10-15-23-13-6-8-19-26(23)28)29-22-11-16-24-14-7-9-20-27(24)29/h3-11,13-22,30-31H,2,12H2,1H3/t30-/m1/s1 |
| InChIKey | NLSSBRWFHMPMCO-SSEXGKCCSA-N |
| XLogP | 7.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate?
The IUPAC name of dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate (CID 166440086) is dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate.
What is the SMILES notation for dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate?
The canonical SMILES for dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate is CCC[C@@H](Oc1ccccc1)C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12.
What is the InChIKey of dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate?
The InChIKey is NLSSBRWFHMPMCO-SSEXGKCCSA-N. The full InChI is InChI=1S/C32H28O3/c1-2-12-30(34-25-17-4-3-5-18-25)32(33)35-31(28-21-10-15-23-13-6-8-19-26(23)28)29-22-11-16-24-14-7-9-20-27(24)29/h3-11,13-22,30-31H,2,12H2,1H3/t30-/m1/s1.
What are the key properties of dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate?
dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate has a molecular weight of 460.57 g/mol, XLogP of 7.87, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dinaphthalen-1-ylmethyl (2R)-2-phenoxypentanoate is sourced from PubChem (CID 166440086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).