About 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate
1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate (PubChem CID 100987751) has the molecular formula C24H24O4
and a molecular weight of 376.45 g/mol. Its IUPAC name is 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate |
| PubChem CID | 100987751 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate |
| SMILES | COC(=O)CC(CC(=O)O[C@H](C)c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H24O4/c1-17(21-14-8-12-19-11-6-7-13-22(19)21)28-24(26)16-20(15-23(25)27-2)18-9-4-3-5-10-18/h3-14,17,20H,15-16H2,1-2H3/t17-,20?/m1/s1 |
| InChIKey | CIYWGQSZTKQJFF-DIAVIDTQSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate?
The IUPAC name of 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate (CID 100987751) is 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate.
What is the SMILES notation for 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate?
The canonical SMILES for 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate is COC(=O)CC(CC(=O)O[C@H](C)c1cccc2ccccc12)c1ccccc1.
What is the InChIKey of 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate?
The InChIKey is CIYWGQSZTKQJFF-DIAVIDTQSA-N. The full InChI is InChI=1S/C24H24O4/c1-17(21-14-8-12-19-11-6-7-13-22(19)21)28-24(26)16-20(15-23(25)27-2)18-9-4-3-5-10-18/h3-14,17,20H,15-16H2,1-2H3/t17-,20?/m1/s1.
What are the key properties of 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate?
1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate has a molecular weight of 376.45 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 5-O-[(1R)-1-naphthalen-1-ylethyl] (3S)-3-phenylpentanedioate is sourced from PubChem (CID 100987751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).