C20H18O3 — CID 10852177
methyl (2S,3S)-3-hydroxy-3-naphthalen-1-yl-2-phenylpropanoate (PubChem CID 10852177) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl (2S,3S)-3-hydroxy-3-naphthalen-1-yl-2-phenylpropanoate.
| Compound Name | methyl (2S,3S)-3-hydroxy-3-naphthalen-1-yl-2-phenylpropanoate |
|---|---|
| PubChem CID | 10852177 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | methyl (2S,3S)-3-hydroxy-3-naphthalen-1-yl-2-phenylpropanoate |
| SMILES | COC(=O)[C@@H](c1ccccc1)[C@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18O3/c1-23-20(22)18(15-9-3-2-4-10-15)19(21)17-13-7-11-14-8-5-6-12-16(14)17/h2-13,18-19,21H,1H3/t18-,19+/m0/s1 |
| InChIKey | NPQNJLCYFCTPEO-RBUKOAKNSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |