C14H11Cl3O2 — CID 174899487
methyl 3,3,3-trichloro-2-naphthalen-1-ylpropanoate (PubChem CID 174899487) has the molecular formula C14H11Cl3O2 and a molecular weight of 317.60 g/mol. Its IUPAC name is methyl 3,3,3-trichloro-2-naphthalen-1-ylpropanoate.
| Compound Name | methyl 3,3,3-trichloro-2-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 174899487 |
| Molecular Formula | C14H11Cl3O2 |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | methyl 3,3,3-trichloro-2-naphthalen-1-ylpropanoate |
| SMILES | COC(=O)C(c1cccc2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H11Cl3O2/c1-19-13(18)12(14(15,16)17)11-8-4-6-9-5-2-3-7-10(9)11/h2-8,12H,1H3 |
| InChIKey | KBNFYXYQQKEJED-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|