methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate

C16H15BrO3 — CID 72545735

IUPACmethyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate
SMILESCOC(=O)[C@@H](c1ccccc1)[C@@H](O)c1ccc(Br)cc1
InChIInChI=1S/C16H15BrO3/c1-20-16(19)14(11-5-3-2-4-6-11)15(18)12-7-9-13(17)10-8-12/h2-10,14-15,18H,1H3/t14-,15-/m0/s1
InChIKeySTENKBIKKXPAHD-GJZGRUSLSA-N
MW335.20 g/mol
LogP3.44
Rot. Bonds4

About methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate

methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate (PubChem CID 72545735) has the molecular formula C16H15BrO3 and a molecular weight of 335.20 g/mol. Its IUPAC name is methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate.

Molecular Properties

Compound Namemethyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate
PubChem CID72545735
Molecular FormulaC16H15BrO3
Molecular Weight335.20 g/mol
Exact Mass334.02
IUPAC Namemethyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate
SMILESCOC(=O)[C@@H](c1ccccc1)[C@@H](O)c1ccc(Br)cc1
InChIInChI=1S/C16H15BrO3/c1-20-16(19)14(11-5-3-2-4-6-11)15(18)12-7-9-13(17)10-8-12/h2-10,14-15,18H,1H3/t14-,15-/m0/s1
InChIKeySTENKBIKKXPAHD-GJZGRUSLSA-N
XLogP3.44
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.20
LogP ≤ 53.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate?
The IUPAC name of methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate (CID 72545735) is methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate.
What is the SMILES notation for methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate?
The canonical SMILES for methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate is COC(=O)[C@@H](c1ccccc1)[C@@H](O)c1ccc(Br)cc1.
What is the InChIKey of methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate?
The InChIKey is STENKBIKKXPAHD-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H15BrO3/c1-20-16(19)14(11-5-3-2-4-6-11)15(18)12-7-9-13(17)10-8-12/h2-10,14-15,18H,1H3/t14-,15-/m0/s1.
What are the key properties of methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate?
methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate has a molecular weight of 335.20 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3R)-3-(4-bromophenyl)-3-hydroxy-2-phenylpropanoate is sourced from PubChem (CID 72545735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).