C19H16BrF3O3 — CID 162536905
methyl (2R,3R)-2-(4-bromophenyl)-6,6,6-trifluoro-5-oxo-3-phenylhexanoate (PubChem CID 162536905) has the molecular formula C19H16BrF3O3 and a molecular weight of 429.23 g/mol. Its IUPAC name is methyl (2R,3R)-2-(4-bromophenyl)-6,6,6-trifluoro-5-oxo-3-phenylhexanoate.
| Compound Name | methyl (2R,3R)-2-(4-bromophenyl)-6,6,6-trifluoro-5-oxo-3-phenylhexanoate |
|---|---|
| PubChem CID | 162536905 |
| Molecular Formula | C19H16BrF3O3 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | methyl (2R,3R)-2-(4-bromophenyl)-6,6,6-trifluoro-5-oxo-3-phenylhexanoate |
| SMILES | COC(=O)[C@@H](c1ccc(Br)cc1)[C@@H](CC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H16BrF3O3/c1-26-18(25)17(13-7-9-14(20)10-8-13)15(11-16(24)19(21,22)23)12-5-3-2-4-6-12/h2-10,15,17H,11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | BDRCXVFCLDQUAK-RDJZCZTQSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |