C17H17BrO4 — CID 70277013
methyl 3-(4-bromophenyl)-2,4-dihydroxy-3-phenylbutanoate (PubChem CID 70277013) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-2,4-dihydroxy-3-phenylbutanoate.
| Compound Name | methyl 3-(4-bromophenyl)-2,4-dihydroxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 70277013 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | methyl 3-(4-bromophenyl)-2,4-dihydroxy-3-phenylbutanoate |
| SMILES | COC(=O)C(O)C(CO)(c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrO4/c1-22-16(21)15(20)17(11-19,12-5-3-2-4-6-12)13-7-9-14(18)10-8-13/h2-10,15,19-20H,11H2,1H3 |
| InChIKey | CTCHIEHGELUCIU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |