C18H20BrNO3 — CID 10595796
methyl (2R)-2-(4-bromophenyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]propanoate (PubChem CID 10595796) has the molecular formula C18H20BrNO3 and a molecular weight of 378.27 g/mol. Its IUPAC name is methyl (2R)-2-(4-bromophenyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]propanoate.
| Compound Name | methyl (2R)-2-(4-bromophenyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]propanoate |
|---|---|
| PubChem CID | 10595796 |
| Molecular Formula | C18H20BrNO3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | methyl (2R)-2-(4-bromophenyl)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]propanoate |
| SMILES | COC(=O)[C@](C)(N[C@@H](CO)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrNO3/c1-18(17(22)23-2,14-8-10-15(19)11-9-14)20-16(12-21)13-6-4-3-5-7-13/h3-11,16,20-21H,12H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | MYBLKIUDSZNHEV-FUHWJXTLSA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |