C28H20Br2O2 — CID 134852094
1,4-bis(4-bromophenyl)-2,3-diphenylbutane-1,4-dione (PubChem CID 134852094) has the molecular formula C28H20Br2O2 and a molecular weight of 548.27 g/mol. Its IUPAC name is 1,4-bis(4-bromophenyl)-2,3-diphenylbutane-1,4-dione.
| Compound Name | 1,4-bis(4-bromophenyl)-2,3-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 134852094 |
| Molecular Formula | C28H20Br2O2 |
| Molecular Weight | 548.27 g/mol |
| Exact Mass | 545.98 |
| IUPAC Name | 1,4-bis(4-bromophenyl)-2,3-diphenylbutane-1,4-dione |
| SMILES | O=C(c1ccc(Br)cc1)C(c1ccccc1)C(C(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H20Br2O2/c29-23-15-11-21(12-16-23)27(31)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)28(32)22-13-17-24(30)18-14-22/h1-18,25-26H |
| InChIKey | FBRNSNKRORLKTQ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.27 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |