C17H15BrO2 — CID 173018498
4-(4-bromophenyl)-2-methyl-1-phenylbutane-1,4-dione (PubChem CID 173018498) has the molecular formula C17H15BrO2 and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-methyl-1-phenylbutane-1,4-dione.
| Compound Name | 4-(4-bromophenyl)-2-methyl-1-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 173018498 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 4-(4-bromophenyl)-2-methyl-1-phenylbutane-1,4-dione |
| SMILES | CC(CC(=O)c1ccc(Br)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15BrO2/c1-12(17(20)14-5-3-2-4-6-14)11-16(19)13-7-9-15(18)10-8-13/h2-10,12H,11H2,1H3 |
| InChIKey | VCIMIULORBRGDH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |