C13H15BrO2 — CID 51567159
(3S)-1-(4-bromophenyl)-3-methylhexane-1,5-dione (PubChem CID 51567159) has the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. Its IUPAC name is (3S)-1-(4-bromophenyl)-3-methylhexane-1,5-dione.
| Compound Name | (3S)-1-(4-bromophenyl)-3-methylhexane-1,5-dione |
|---|---|
| PubChem CID | 51567159 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (3S)-1-(4-bromophenyl)-3-methylhexane-1,5-dione |
| SMILES | CC(=O)C[C@H](C)CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H15BrO2/c1-9(7-10(2)15)8-13(16)11-3-5-12(14)6-4-11/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | GXIZPWDFYZDAMM-VIFPVBQESA-N |
| XLogP | 3.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |