C10H8BrCl3O2 — CID 766976
(3R)-1-(4-bromophenyl)-4,4,4-trichloro-3-hydroxybutan-1-one (PubChem CID 766976) has the molecular formula C10H8BrCl3O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-4,4,4-trichloro-3-hydroxybutan-1-one.
| Compound Name | (3R)-1-(4-bromophenyl)-4,4,4-trichloro-3-hydroxybutan-1-one |
|---|---|
| PubChem CID | 766976 |
| Molecular Formula | C10H8BrCl3O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 343.88 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-4,4,4-trichloro-3-hydroxybutan-1-one |
| SMILES | O=C(C[C@@H](O)C(Cl)(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H8BrCl3O2/c11-7-3-1-6(2-4-7)8(15)5-9(16)10(12,13)14/h1-4,9,16H,5H2/t9-/m1/s1 |
| InChIKey | ACTXJPUTDGCSGH-SECBINFHSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|