About 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone
1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone (PubChem CID 134926841) has the molecular formula C8H6Br4OTe
and a molecular weight of 565.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone |
| PubChem CID | 134926841 |
| Molecular Formula | C8H6Br4OTe |
| Molecular Weight | 565.35 g/mol |
| Exact Mass | 563.62 |
| IUPAC Name | 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone |
| SMILES | O=C(C[Te](Br)(Br)Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H6Br4OTe/c9-7-3-1-6(2-4-7)8(13)5-14(10,11)12/h1-4H,5H2 |
| InChIKey | ZIQVPQMDBZSCDS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone?
The IUPAC name of 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone (CID 134926841) is 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone.
What is the SMILES notation for 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone?
The canonical SMILES for 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone is O=C(C[Te](Br)(Br)Br)c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone?
The InChIKey is ZIQVPQMDBZSCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br4OTe/c9-7-3-1-6(2-4-7)8(13)5-14(10,11)12/h1-4H,5H2.
What are the key properties of 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone?
1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone has a molecular weight of 565.35 g/mol, XLogP of 4.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(tribromo-λ4-tellanyl)ethanone is sourced from PubChem (CID 134926841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).