C23H17Br3O3 — CID 102105842
(4-bromophenyl)methyl 2,4-bis(4-bromophenyl)-4-oxobutanoate (PubChem CID 102105842) has the molecular formula C23H17Br3O3 and a molecular weight of 581.10 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2,4-bis(4-bromophenyl)-4-oxobutanoate.
| Compound Name | (4-bromophenyl)methyl 2,4-bis(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 102105842 |
| Molecular Formula | C23H17Br3O3 |
| Molecular Weight | 581.10 g/mol |
| Exact Mass | 577.87 |
| IUPAC Name | (4-bromophenyl)methyl 2,4-bis(4-bromophenyl)-4-oxobutanoate |
| SMILES | O=C(CC(C(=O)OCc1ccc(Br)cc1)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H17Br3O3/c24-18-7-1-15(2-8-18)14-29-23(28)21(16-3-9-19(25)10-4-16)13-22(27)17-5-11-20(26)12-6-17/h1-12,21H,13-14H2 |
| InChIKey | CSPJQYJQDKUMCA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.10 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |