About (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate
(4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate (PubChem CID 102105843) has the molecular formula C24H20Br2O4
and a molecular weight of 532.23 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate |
| PubChem CID | 102105843 |
| Molecular Formula | C24H20Br2O4 |
| Molecular Weight | 532.23 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate |
| SMILES | COc1ccc(C(=O)CC(C(=O)OCc2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H20Br2O4/c1-29-21-12-6-18(7-13-21)23(27)14-22(17-4-10-20(26)11-5-17)24(28)30-15-16-2-8-19(25)9-3-16/h2-13,22H,14-15H2,1H3 |
| InChIKey | PBQSMRBASLKNIV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.23 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate?
The IUPAC name of (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate (CID 102105843) is (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate.
What is the SMILES notation for (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate?
The canonical SMILES for (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate is COc1ccc(C(=O)CC(C(=O)OCc2ccc(Br)cc2)c2ccc(Br)cc2)cc1.
What is the InChIKey of (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate?
The InChIKey is PBQSMRBASLKNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20Br2O4/c1-29-21-12-6-18(7-13-21)23(27)14-22(17-4-10-20(26)11-5-17)24(28)30-15-16-2-8-19(25)9-3-16/h2-13,22H,14-15H2,1H3.
What are the key properties of (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate?
(4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate has a molecular weight of 532.23 g/mol, XLogP of 6.32, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl 2-(4-bromophenyl)-4-(4-methoxyphenyl)-4-oxobutanoate is sourced from PubChem (CID 102105843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).