C23H21NO3 — CID 177441445
1-(2-aminophenyl)-2-(4-methoxyphenyl)-4-phenylbutane-1,4-dione (PubChem CID 177441445) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-(4-methoxyphenyl)-4-phenylbutane-1,4-dione.
| Compound Name | 1-(2-aminophenyl)-2-(4-methoxyphenyl)-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 177441445 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(2-aminophenyl)-2-(4-methoxyphenyl)-4-phenylbutane-1,4-dione |
| SMILES | COc1ccc(C(CC(=O)c2ccccc2)C(=O)c2ccccc2N)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-27-18-13-11-16(12-14-18)20(15-22(25)17-7-3-2-4-8-17)23(26)19-9-5-6-10-21(19)24/h2-14,20H,15,24H2,1H3 |
| InChIKey | OIXVXZGQQDUGKG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|