C22H21NO2S — CID 6962251
(3R)-3-(2-aminophenyl)sulfanyl-3-(4-methoxyphenyl)-1-phenylpropan-1-one (PubChem CID 6962251) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is (3R)-3-(2-aminophenyl)sulfanyl-3-(4-methoxyphenyl)-1-phenylpropan-1-one.
| Compound Name | (3R)-3-(2-aminophenyl)sulfanyl-3-(4-methoxyphenyl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 6962251 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (3R)-3-(2-aminophenyl)sulfanyl-3-(4-methoxyphenyl)-1-phenylpropan-1-one |
| SMILES | COc1ccc([C@@H](CC(=O)c2ccccc2)Sc2ccccc2N)cc1 |
| InChI | InChI=1S/C22H21NO2S/c1-25-18-13-11-17(12-14-18)22(26-21-10-6-5-9-19(21)23)15-20(24)16-7-3-2-4-8-16/h2-14,22H,15,23H2,1H3/t22-/m1/s1 |
| InChIKey | HWPQIBQOCNDZBR-JOCHJYFZSA-N |
| XLogP | 5.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|