C22H20N2O3S — CID 6977327
(3S)-3-(2-aminophenyl)sulfanyl-1-(4-methylphenyl)-3-(4-nitrophenyl)propan-1-one (PubChem CID 6977327) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is (3S)-3-(2-aminophenyl)sulfanyl-1-(4-methylphenyl)-3-(4-nitrophenyl)propan-1-one.
| Compound Name | (3S)-3-(2-aminophenyl)sulfanyl-1-(4-methylphenyl)-3-(4-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 6977327 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (3S)-3-(2-aminophenyl)sulfanyl-1-(4-methylphenyl)-3-(4-nitrophenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)C[C@H](Sc2ccccc2N)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-15-6-8-16(9-7-15)20(25)14-22(28-21-5-3-2-4-19(21)23)17-10-12-18(13-11-17)24(26)27/h2-13,22H,14,23H2,1H3/t22-/m0/s1 |
| InChIKey | UXGRKXNPHOMTIW-QFIPXVFZSA-N |
| XLogP | 5.59 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|