C25H26ClNOS — CID 2733066
3-(2-aminophenyl)sulfanyl-3-(4-chlorophenyl)-1-[4-(2-methylpropyl)phenyl]propan-1-one (PubChem CID 2733066) has the molecular formula C25H26ClNOS and a molecular weight of 424.01 g/mol. Its IUPAC name is 3-(2-aminophenyl)sulfanyl-3-(4-chlorophenyl)-1-[4-(2-methylpropyl)phenyl]propan-1-one.
| Compound Name | 3-(2-aminophenyl)sulfanyl-3-(4-chlorophenyl)-1-[4-(2-methylpropyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 2733066 |
| Molecular Formula | C25H26ClNOS |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-(2-aminophenyl)sulfanyl-3-(4-chlorophenyl)-1-[4-(2-methylpropyl)phenyl]propan-1-one |
| SMILES | CC(C)Cc1ccc(C(=O)CC(Sc2ccccc2N)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H26ClNOS/c1-17(2)15-18-7-9-19(10-8-18)23(28)16-25(20-11-13-21(26)14-12-20)29-24-6-4-3-5-22(24)27/h3-14,17,25H,15-16,27H2,1-2H3 |
| InChIKey | FWUABUZBXWBWGF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|