C23H22BrNO3S — CID 27017485
(3S)-3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propan-1-one (PubChem CID 27017485) has the molecular formula C23H22BrNO3S and a molecular weight of 472.40 g/mol. Its IUPAC name is (3S)-3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propan-1-one.
| Compound Name | (3S)-3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 27017485 |
| Molecular Formula | C23H22BrNO3S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | (3S)-3-(2-aminophenyl)sulfanyl-1-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc([C@H](CC(=O)c2ccc(Br)cc2)Sc2ccccc2N)cc1OC |
| InChI | InChI=1S/C23H22BrNO3S/c1-27-20-12-9-16(13-21(20)28-2)23(29-22-6-4-3-5-18(22)25)14-19(26)15-7-10-17(24)11-8-15/h3-13,23H,14,25H2,1-2H3/t23-/m0/s1 |
| InChIKey | DLFQCPHXXJCSDT-QHCPKHFHSA-N |
| XLogP | 6.15 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|