C24H25NO3S — CID 1212518
(3R)-3-(2-aminophenyl)sulfanyl-3-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)propan-1-one (PubChem CID 1212518) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is (3R)-3-(2-aminophenyl)sulfanyl-3-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)propan-1-one.
| Compound Name | (3R)-3-(2-aminophenyl)sulfanyl-3-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 1212518 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (3R)-3-(2-aminophenyl)sulfanyl-3-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)propan-1-one |
| SMILES | COc1ccc([C@@H](CC(=O)c2ccc(C)cc2)Sc2ccccc2N)cc1OC |
| InChI | InChI=1S/C24H25NO3S/c1-16-8-10-17(11-9-16)20(26)15-24(29-23-7-5-4-6-19(23)25)18-12-13-21(27-2)22(14-18)28-3/h4-14,24H,15,25H2,1-3H3/t24-/m1/s1 |
| InChIKey | SCIHLOAUPVYUKB-XMMPIXPASA-N |
| XLogP | 5.70 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|